C22H18N2 — CID 102265400
2-phenyl-6-(6-phenyl-1,2-dihydropyridin-2-yl)pyridine (PubChem CID 102265400) has the molecular formula C22H18N2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-phenyl-6-(6-phenyl-1,2-dihydropyridin-2-yl)pyridine.
| Compound Name | 2-phenyl-6-(6-phenyl-1,2-dihydropyridin-2-yl)pyridine |
|---|---|
| PubChem CID | 102265400 |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-phenyl-6-(6-phenyl-1,2-dihydropyridin-2-yl)pyridine |
| SMILES | C1=CC(c2cccc(-c3ccccc3)n2)NC(c2ccccc2)=C1 |
| InChI | InChI=1S/C22H18N2/c1-3-9-17(10-4-1)19-13-7-15-21(23-19)22-16-8-14-20(24-22)18-11-5-2-6-12-18/h1-16,21,23H |
| InChIKey | OPBUEUVMDCFVSX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |