C47H36N2O2 — CID 118860653
2-phenyl-6-[3-(6-phenyl-1,2-dihydropyridin-2-yl)spiro[1,2,8,8a-tetrahydroxanthene-9,9'-xanthene]-3'-yl]pyridine (PubChem CID 118860653) has the molecular formula C47H36N2O2 and a molecular weight of 660.82 g/mol. Its IUPAC name is 2-phenyl-6-[3-(6-phenyl-1,2-dihydropyridin-2-yl)spiro[1,2,8,8a-tetrahydroxanthene-9,9'-xanthene]-3'-yl]pyridine.
| Compound Name | 2-phenyl-6-[3-(6-phenyl-1,2-dihydropyridin-2-yl)spiro[1,2,8,8a-tetrahydroxanthene-9,9'-xanthene]-3'-yl]pyridine |
|---|---|
| PubChem CID | 118860653 |
| Molecular Formula | C47H36N2O2 |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | 2-phenyl-6-[3-(6-phenyl-1,2-dihydropyridin-2-yl)spiro[1,2,8,8a-tetrahydroxanthene-9,9'-xanthene]-3'-yl]pyridine |
| SMILES | C1=CCC2C(=C1)OC1=C(CCC(C3C=CC=C(c4ccccc4)N3)=C1)C21c2ccccc2Oc2cc(-c3cccc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C47H36N2O2/c1-3-13-31(14-4-1)39-19-11-21-41(48-39)33-25-27-37-45(29-33)50-43-23-9-7-17-35(43)47(37)36-18-8-10-24-44(36)51-46-30-34(26-28-38(46)47)42-22-12-20-40(49-42)32-15-5-2-6-16-32/h1-17,19-25,27,29-30,36,42,49H,18,26,28H2 |
| InChIKey | DZURTVXJUQUNAM-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |