C43H36P2 — CID 102270266
[(R)-[5-[(R)-diphenylphosphanyl(phenyl)methyl]cyclopenta-1,4-dien-1-yl]-phenylmethyl]-diphenylphosphane (PubChem CID 102270266) has the molecular formula C43H36P2 and a molecular weight of 614.71 g/mol. Its IUPAC name is [(R)-[5-[(R)-diphenylphosphanyl(phenyl)methyl]cyclopenta-1,4-dien-1-yl]-phenylmethyl]-diphenylphosphane.
| Compound Name | [(R)-[5-[(R)-diphenylphosphanyl(phenyl)methyl]cyclopenta-1,4-dien-1-yl]-phenylmethyl]-diphenylphosphane |
|---|---|
| PubChem CID | 102270266 |
| Molecular Formula | C43H36P2 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | [(R)-[5-[(R)-diphenylphosphanyl(phenyl)methyl]cyclopenta-1,4-dien-1-yl]-phenylmethyl]-diphenylphosphane |
| SMILES | C1=C([C@@H](c2ccccc2)P(c2ccccc2)c2ccccc2)C([C@@H](c2ccccc2)P(c2ccccc2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C43H36P2/c1-7-20-34(21-8-1)42(44(36-24-11-3-12-25-36)37-26-13-4-14-27-37)40-32-19-33-41(40)43(35-22-9-2-10-23-35)45(38-28-15-5-16-29-38)39-30-17-6-18-31-39/h1-18,20-33,42-43H,19H2/t42-,43-/m1/s1 |
| InChIKey | XDKZUKJPSAWMLY-OCQXTOTRSA-N |
| XLogP | 9.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|