C19H28O — CID 102270589
(1S,2R,5R,7R,8R,10R,11S,15R)-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadec-12-en-8-ol (PubChem CID 102270589) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,10R,11S,15R)-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadec-12-en-8-ol.
| Compound Name | (1S,2R,5R,7R,8R,10R,11S,15R)-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadec-12-en-8-ol |
|---|---|
| PubChem CID | 102270589 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (1S,2R,5R,7R,8R,10R,11S,15R)-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadec-12-en-8-ol |
| SMILES | C[C@@]12CC=C[C@H]1[C@@H]1C[C@@H](O)[C@]34C[C@H]3CC[C@]4(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H28O/c1-17-7-3-4-14(17)13-10-16(20)19-11-12(19)5-9-18(19,2)15(13)6-8-17/h3-4,12-16,20H,5-11H2,1-2H3/t12-,13+,14+,15+,16-,17+,18-,19+/m1/s1 |
| InChIKey | DGXRYCAEWFUZJR-HGKNBMNWSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|