C19H28O2 — CID 69397998
(5R,8R,9S,10R,13R,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,17-decahydrocyclopenta[a]phenanthrene-3,3-diol (PubChem CID 69397998) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (5R,8R,9S,10R,13R,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,17-decahydrocyclopenta[a]phenanthrene-3,3-diol.
| Compound Name | (5R,8R,9S,10R,13R,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,17-decahydrocyclopenta[a]phenanthrene-3,3-diol |
|---|---|
| PubChem CID | 69397998 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (5R,8R,9S,10R,13R,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,17-decahydrocyclopenta[a]phenanthrene-3,3-diol |
| SMILES | C[C@@]12CC=C[C@H]1[C@@H]1CC[C@@H]3CC(O)(O)C=C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H28O2/c1-17-8-3-4-15(17)14-6-5-13-12-19(20,21)11-10-18(13,2)16(14)7-9-17/h3-4,10-11,13-16,20-21H,5-9,12H2,1-2H3/t13-,14+,15+,16+,17+,18+/m1/s1 |
| InChIKey | YMYOTLORTIWOES-PXOUGSPUSA-N |
| XLogP | 3.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|