C20H23NO8 — CID 102271985
methyl (2R,3S,5R,6R)-3-(2,5-dioxo-1-phenylpyrrol-3-yl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate (PubChem CID 102271985) has the molecular formula C20H23NO8 and a molecular weight of 405.40 g/mol. Its IUPAC name is methyl (2R,3S,5R,6R)-3-(2,5-dioxo-1-phenylpyrrol-3-yl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate.
| Compound Name | methyl (2R,3S,5R,6R)-3-(2,5-dioxo-1-phenylpyrrol-3-yl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 102271985 |
| Molecular Formula | C20H23NO8 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | methyl (2R,3S,5R,6R)-3-(2,5-dioxo-1-phenylpyrrol-3-yl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@H]1C1=CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H23NO8/c1-19(26-4)20(2,27-5)29-16(18(24)25-3)15(28-19)13-11-14(22)21(17(13)23)12-9-7-6-8-10-12/h6-11,15-16H,1-5H3/t15-,16+,19+,20+/m0/s1 |
| InChIKey | PNYQAOBIHKXJJJ-LNKGRISISA-N |
| XLogP | 1.17 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|