C15H16OS2 — CID 102274006
1-phenoxy-3-phenylsulfanylpropane-2-thiol (PubChem CID 102274006) has the molecular formula C15H16OS2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 1-phenoxy-3-phenylsulfanylpropane-2-thiol.
| Compound Name | 1-phenoxy-3-phenylsulfanylpropane-2-thiol |
|---|---|
| PubChem CID | 102274006 |
| Molecular Formula | C15H16OS2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1-phenoxy-3-phenylsulfanylpropane-2-thiol |
| SMILES | SC(COc1ccccc1)CSc1ccccc1 |
| InChI | InChI=1S/C15H16OS2/c17-14(11-16-13-7-3-1-4-8-13)12-18-15-9-5-2-6-10-15/h1-10,14,17H,11-12H2 |
| InChIKey | NRNATJAFZCGNOU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|