C28H27BP+ — CID 102274535
5-methyl-5-phenyl-10-(2,4,6-trimethylphenyl)benzo[b][1,4]benzophosphaborinin-5-ium (PubChem CID 102274535) has the molecular formula C28H27BP+ and a molecular weight of 405.31 g/mol. Its IUPAC name is 5-methyl-5-phenyl-10-(2,4,6-trimethylphenyl)benzo[b][1,4]benzophosphaborinin-5-ium.
| Compound Name | 5-methyl-5-phenyl-10-(2,4,6-trimethylphenyl)benzo[b][1,4]benzophosphaborinin-5-ium |
|---|---|
| PubChem CID | 102274535 |
| Molecular Formula | C28H27BP+ |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 5-methyl-5-phenyl-10-(2,4,6-trimethylphenyl)benzo[b][1,4]benzophosphaborinin-5-ium |
| SMILES | Cc1cc(C)c(B2c3ccccc3[P+](C)(c3ccccc3)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C28H27BP/c1-20-18-21(2)28(22(3)19-20)29-24-14-8-10-16-26(24)30(4,23-12-6-5-7-13-23)27-17-11-9-15-25(27)29/h5-19H,1-4H3/q+1 |
| InChIKey | MSEMKNZRFCSFQW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|