C44H40B2Cl6 — CID 139122397
chloroform;2,7-diphenyl-5,10-bis(2,4,6-trimethylphenyl)boranthrene (PubChem CID 139122397) has the molecular formula C44H40B2Cl6 and a molecular weight of 803.15 g/mol. Its IUPAC name is chloroform;2,7-diphenyl-5,10-bis(2,4,6-trimethylphenyl)boranthrene.
| Compound Name | chloroform;2,7-diphenyl-5,10-bis(2,4,6-trimethylphenyl)boranthrene |
|---|---|
| PubChem CID | 139122397 |
| Molecular Formula | C44H40B2Cl6 |
| Molecular Weight | 803.15 g/mol |
| Exact Mass | 800.14 |
| IUPAC Name | chloroform;2,7-diphenyl-5,10-bis(2,4,6-trimethylphenyl)boranthrene |
| SMILES | Cc1cc(C)c(B2c3ccc(-c4ccccc4)cc3B(c3c(C)cc(C)cc3C)c3ccc(-c4ccccc4)cc32)c(C)c1.ClC(Cl)Cl.ClC(Cl)Cl |
| InChI | InChI=1S/C42H38B2.2CHCl3/c1-27-21-29(3)41(30(4)22-27)43-37-19-17-36(34-15-11-8-12-16-34)26-40(37)44(42-31(5)23-28(2)24-32(42)6)38-20-18-35(25-39(38)43)33-13-9-7-10-14-33;2*2-1(3)4/h7-26H,1-6H3;2*1H |
| InChIKey | RBFAYLVUDRMMRY-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.15 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|