C28H32O9 — CID 102275267
diethyl 1-[4,4-bis(ethoxycarbonyl)-2-methylidenecyclopentyl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 102275267) has the molecular formula C28H32O9 and a molecular weight of 512.56 g/mol. Its IUPAC name is diethyl 1-[4,4-bis(ethoxycarbonyl)-2-methylidenecyclopentyl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | diethyl 1-[4,4-bis(ethoxycarbonyl)-2-methylidenecyclopentyl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 102275267 |
| Molecular Formula | C28H32O9 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | diethyl 1-[4,4-bis(ethoxycarbonyl)-2-methylidenecyclopentyl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)CC1C12OC(C(C(=O)OCC)=C1C(=O)OCC)c1ccccc12 |
| InChI | InChI=1S/C28H32O9/c1-6-33-23(29)20-21(24(30)34-7-2)28(18-13-11-10-12-17(18)22(20)37-28)19-15-27(14-16(19)5,25(31)35-8-3)26(32)36-9-4/h10-13,19,22H,5-9,14-15H2,1-4H3 |
| InChIKey | YSXZBWBFJLGPEW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|