C22H25IO4 — CID 102276269
(3R,3aS,4S,5S,6S,7aR)-3-iodo-6-methyl-4,5-bis(phenylmethoxy)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran (PubChem CID 102276269) has the molecular formula C22H25IO4 and a molecular weight of 480.34 g/mol. Its IUPAC name is (3R,3aS,4S,5S,6S,7aR)-3-iodo-6-methyl-4,5-bis(phenylmethoxy)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran.
| Compound Name | (3R,3aS,4S,5S,6S,7aR)-3-iodo-6-methyl-4,5-bis(phenylmethoxy)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran |
|---|---|
| PubChem CID | 102276269 |
| Molecular Formula | C22H25IO4 |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (3R,3aS,4S,5S,6S,7aR)-3-iodo-6-methyl-4,5-bis(phenylmethoxy)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran |
| SMILES | C[C@@H]1O[C@H]2OC[C@H](I)[C@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H25IO4/c1-15-20(24-12-16-8-4-2-5-9-16)21(19-18(23)14-26-22(19)27-15)25-13-17-10-6-3-7-11-17/h2-11,15,18-22H,12-14H2,1H3/t15-,18-,19-,20-,21-,22+/m0/s1 |
| InChIKey | BTKKEOISULTNJS-VKWHKABCSA-N |
| XLogP | 4.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|