C13H17NO2S — CID 102276882
(5S)-2-tert-butyl-1-oxo-5-phenyl-1,2-thiazolidin-3-one (PubChem CID 102276882) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is (5S)-2-tert-butyl-1-oxo-5-phenyl-1,2-thiazolidin-3-one.
| Compound Name | (5S)-2-tert-butyl-1-oxo-5-phenyl-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 102276882 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (5S)-2-tert-butyl-1-oxo-5-phenyl-1,2-thiazolidin-3-one |
| SMILES | CC(C)(C)N1C(=O)C[C@@H](c2ccccc2)S1=O |
| InChI | InChI=1S/C13H17NO2S/c1-13(2,3)14-12(15)9-11(17(14)16)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-,17?/m0/s1 |
| InChIKey | DDBKJCAZNGLPCL-PIJUOJQZSA-N |
| XLogP | 2.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |