3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid

C19H16O2S — CID 102278214

IUPAC3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid
SMILESCc1ccc(-c2csc(C(=O)O)c2-c2ccc(C)cc2)cc1
InChIInChI=1S/C19H16O2S/c1-12-3-7-14(8-4-12)16-11-22-18(19(20)21)17(16)15-9-5-13(2)6-10-15/h3-11H,1-2H3,(H,20,21)
InChIKeyCSBQDMYOKLYQNI-UHFFFAOYSA-N
MW308.40 g/mol
LogP5.40
Rot. Bonds3

About 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid

3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid (PubChem CID 102278214) has the molecular formula C19H16O2S and a molecular weight of 308.40 g/mol. Its IUPAC name is 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid.

Molecular Properties

Compound Name3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid
PubChem CID102278214
Molecular FormulaC19H16O2S
Molecular Weight308.40 g/mol
Exact Mass308.09
IUPAC Name3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid
SMILESCc1ccc(-c2csc(C(=O)O)c2-c2ccc(C)cc2)cc1
InChIInChI=1S/C19H16O2S/c1-12-3-7-14(8-4-12)16-11-22-18(19(20)21)17(16)15-9-5-13(2)6-10-15/h3-11H,1-2H3,(H,20,21)
InChIKeyCSBQDMYOKLYQNI-UHFFFAOYSA-N
XLogP5.40
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500308.40
LogP ≤ 55.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid?
The IUPAC name of 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid (CID 102278214) is 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid.
What is the SMILES notation for 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid?
The canonical SMILES for 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid is Cc1ccc(-c2csc(C(=O)O)c2-c2ccc(C)cc2)cc1.
What is the InChIKey of 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid?
The InChIKey is CSBQDMYOKLYQNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O2S/c1-12-3-7-14(8-4-12)16-11-22-18(19(20)21)17(16)15-9-5-13(2)6-10-15/h3-11H,1-2H3,(H,20,21).
What are the key properties of 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid?
3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid has a molecular weight of 308.40 g/mol, XLogP of 5.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid is sourced from PubChem (CID 102278214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).