C19H16O2S — CID 102278214
3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid (PubChem CID 102278214) has the molecular formula C19H16O2S and a molecular weight of 308.40 g/mol. Its IUPAC name is 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid.
| Compound Name | 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102278214 |
| Molecular Formula | C19H16O2S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3,4-bis(4-methylphenyl)thiophene-2-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(C(=O)O)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H16O2S/c1-12-3-7-14(8-4-12)16-11-22-18(19(20)21)17(16)15-9-5-13(2)6-10-15/h3-11H,1-2H3,(H,20,21) |
| InChIKey | CSBQDMYOKLYQNI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |