C26H48O5Si — CID 102283657
methyl (E,2R,4R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-methylidene-10-(oxan-2-yloxy)dec-5-enoate (PubChem CID 102283657) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is methyl (E,2R,4R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-methylidene-10-(oxan-2-yloxy)dec-5-enoate.
| Compound Name | methyl (E,2R,4R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-methylidene-10-(oxan-2-yloxy)dec-5-enoate |
|---|---|
| PubChem CID | 102283657 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | methyl (E,2R,4R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-methylidene-10-(oxan-2-yloxy)dec-5-enoate |
| SMILES | C=C(C[C@@H](COC1CCCCO1)O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)C[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C26H48O5Si/c1-19(16-22(4)25(27)28-8)15-20(2)21(3)17-23(31-32(9,10)26(5,6)7)18-30-24-13-11-12-14-29-24/h15,19,22-24H,3,11-14,16-18H2,1-2,4-10H3/b20-15+/t19-,22+,23-,24?/m0/s1 |
| InChIKey | ZBNPEWUJVWNVRW-QCWSWERASA-N |
| XLogP | 6.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|