C23H42O5Si — CID 102518709
methyl (5Z,7E)-8-[(4R,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-5-yl]octa-5,7-dienoate (PubChem CID 102518709) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is methyl (5Z,7E)-8-[(4R,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-5-yl]octa-5,7-dienoate.
| Compound Name | methyl (5Z,7E)-8-[(4R,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-5-yl]octa-5,7-dienoate |
|---|---|
| PubChem CID | 102518709 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | methyl (5Z,7E)-8-[(4R,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-5-yl]octa-5,7-dienoate |
| SMILES | COC(=O)CCC/C=C\C=C\[C@H]1COC(C)(C)O[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O5Si/c1-22(2,3)29(7,8)27-17-16-20-19(18-26-23(4,5)28-20)14-12-10-9-11-13-15-21(24)25-6/h9-10,12,14,19-20H,11,13,15-18H2,1-8H3/b10-9-,14-12+/t19-,20+/m0/s1 |
| InChIKey | XGVTWQQPXSXZCI-QQMPOGPZSA-N |
| XLogP | 5.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|