C11H12N2O3 — CID 102283763
(1R,8bS)-8b-hydroxy-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indole-1-carboxylic acid (PubChem CID 102283763) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is (1R,8bS)-8b-hydroxy-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indole-1-carboxylic acid.
| Compound Name | (1R,8bS)-8b-hydroxy-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 102283763 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (1R,8bS)-8b-hydroxy-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indole-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CNC2Nc3ccccc3[C@]21O |
| InChI | InChI=1S/C11H12N2O3/c14-9(15)7-5-12-10-11(7,16)6-3-1-2-4-8(6)13-10/h1-4,7,10,12-13,16H,5H2,(H,14,15)/t7-,10?,11+/m0/s1 |
| InChIKey | GYZXOINQLDQFLH-SHGBLELPSA-N |
| XLogP | -0.07 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |