C23H26O2 — CID 102284011
6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione (PubChem CID 102284011) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione.
| Compound Name | 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione |
|---|---|
| PubChem CID | 102284011 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)CCC1(C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H26O2/c1-22(2,3)21(25)15-16(24)13-14-23(4)19-11-7-5-9-17(19)18-10-6-8-12-20(18)23/h5-12H,13-15H2,1-4H3 |
| InChIKey | LLPFBQBTLFGYAM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|