About 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione
6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione (PubChem CID 102284011) has the molecular formula C23H26O2
and a molecular weight of 334.46 g/mol. Its IUPAC name is 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione.
Molecular Properties
| Compound Name | 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione |
| PubChem CID | 102284011 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)CCC1(C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H26O2/c1-22(2,3)21(25)15-16(24)13-14-23(4)19-11-7-5-9-17(19)18-10-6-8-12-20(18)23/h5-12H,13-15H2,1-4H3 |
| InChIKey | LLPFBQBTLFGYAM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione?
The IUPAC name of 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione (CID 102284011) is 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione.
What is the SMILES notation for 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione?
The canonical SMILES for 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione is CC(C)(C)C(=O)CC(=O)CCC1(C)c2ccccc2-c2ccccc21.
What is the InChIKey of 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione?
The InChIKey is LLPFBQBTLFGYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26O2/c1-22(2,3)21(25)15-16(24)13-14-23(4)19-11-7-5-9-17(19)18-10-6-8-12-20(18)23/h5-12H,13-15H2,1-4H3.
What are the key properties of 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione?
6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione has a molecular weight of 334.46 g/mol, XLogP of 5.33, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1-(9-methylfluoren-9-yl)heptane-3,5-dione is sourced from PubChem (CID 102284011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).