C14H9BrS2 — CID 102284509
2-[(4-bromophenyl)methylidene]-1,3-benzodithiole (PubChem CID 102284509) has the molecular formula C14H9BrS2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylidene]-1,3-benzodithiole.
| Compound Name | 2-[(4-bromophenyl)methylidene]-1,3-benzodithiole |
|---|---|
| PubChem CID | 102284509 |
| Molecular Formula | C14H9BrS2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 2-[(4-bromophenyl)methylidene]-1,3-benzodithiole |
| SMILES | Brc1ccc(C=C2Sc3ccccc3S2)cc1 |
| InChI | InChI=1S/C14H9BrS2/c15-11-7-5-10(6-8-11)9-14-16-12-3-1-2-4-13(12)17-14/h1-9H |
| InChIKey | GHJQSJZTTCKHQJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |