C13H15NO — CID 102285040
(1S,6R)-7-(2-methoxyphenyl)-7-azabicyclo[4.1.0]hept-3-ene (PubChem CID 102285040) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (1S,6R)-7-(2-methoxyphenyl)-7-azabicyclo[4.1.0]hept-3-ene.
| Compound Name | (1S,6R)-7-(2-methoxyphenyl)-7-azabicyclo[4.1.0]hept-3-ene |
|---|---|
| PubChem CID | 102285040 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (1S,6R)-7-(2-methoxyphenyl)-7-azabicyclo[4.1.0]hept-3-ene |
| SMILES | COc1ccccc1N1[C@@H]2CC=CC[C@@H]21 |
| InChI | InChI=1S/C13H15NO/c1-15-13-9-5-4-8-12(13)14-10-6-2-3-7-11(10)14/h2-5,8-11H,6-7H2,1H3/t10-,11+,14? |
| InChIKey | PIQOAQHJCBWPBL-BVUQATHDSA-N |
| XLogP | 2.60 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|