C32H41F2NO9Si — CID 102286212
ethyl 2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-yl]-2,2-difluoroacetate (PubChem CID 102286212) has the molecular formula C32H41F2NO9Si and a molecular weight of 649.76 g/mol. Its IUPAC name is ethyl 2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-yl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-yl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 102286212 |
| Molecular Formula | C32H41F2NO9Si |
| Molecular Weight | 649.76 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | ethyl 2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-yl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C32H41F2NO9Si/c1-8-40-30(39)32(33,34)29-26(35-20(2)36)28(43-22(4)38)27(42-21(3)37)25(44-29)19-41-45(31(5,6)7,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,25-29H,8,19H2,1-7H3,(H,35,36)/t25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | FKXBYTMAVNEABO-HWVUQVAQSA-N |
| XLogP | 2.90 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|