methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate

C14H10ClNO2 — CID 102287162

IUPACmethyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate
SMILESCOC(=O)c1cc(Cl)n2ccc3ccccc3c12
InChIInChI=1S/C14H10ClNO2/c1-18-14(17)11-8-12(15)16-7-6-9-4-2-3-5-10(9)13(11)16/h2-8H,1H3
InChIKeyTYEMDKDUSLIKAA-UHFFFAOYSA-N
MW259.69 g/mol
LogP3.53
Rot. Bonds1

About methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate

methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate (PubChem CID 102287162) has the molecular formula C14H10ClNO2 and a molecular weight of 259.69 g/mol. Its IUPAC name is methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate.

Molecular Properties

Compound Namemethyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate
PubChem CID102287162
Molecular FormulaC14H10ClNO2
Molecular Weight259.69 g/mol
Exact Mass259.04
IUPAC Namemethyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate
SMILESCOC(=O)c1cc(Cl)n2ccc3ccccc3c12
InChIInChI=1S/C14H10ClNO2/c1-18-14(17)11-8-12(15)16-7-6-9-4-2-3-5-10(9)13(11)16/h2-8H,1H3
InChIKeyTYEMDKDUSLIKAA-UHFFFAOYSA-N
XLogP3.53
TPSA30.71 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.69
LogP ≤ 53.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate?
The IUPAC name of methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate (CID 102287162) is methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate.
What is the SMILES notation for methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate?
The canonical SMILES for methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate is COC(=O)c1cc(Cl)n2ccc3ccccc3c12.
What is the InChIKey of methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate?
The InChIKey is TYEMDKDUSLIKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClNO2/c1-18-14(17)11-8-12(15)16-7-6-9-4-2-3-5-10(9)13(11)16/h2-8H,1H3.
What are the key properties of methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate?
methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate has a molecular weight of 259.69 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloropyrrolo[2,1-a]isoquinoline-1-carboxylate is sourced from PubChem (CID 102287162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).