C15H11ClO4 — CID 102287339
(11R,15S,16R)-5-chloro-16-methyl-9,14,17-trioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,12-pentaen-2-one (PubChem CID 102287339) has the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. Its IUPAC name is (11R,15S,16R)-5-chloro-16-methyl-9,14,17-trioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,12-pentaen-2-one.
| Compound Name | (11R,15S,16R)-5-chloro-16-methyl-9,14,17-trioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,12-pentaen-2-one |
|---|---|
| PubChem CID | 102287339 |
| Molecular Formula | C15H11ClO4 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (11R,15S,16R)-5-chloro-16-methyl-9,14,17-trioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,12-pentaen-2-one |
| SMILES | C[C@H]1Oc2c(oc3ccc(Cl)cc3c2=O)[C@@H]2C=CO[C@H]12 |
| InChI | InChI=1S/C15H11ClO4/c1-7-13-9(4-5-18-13)14-15(19-7)12(17)10-6-8(16)2-3-11(10)20-14/h2-7,9,13H,1H3/t7-,9-,13-/m1/s1 |
| InChIKey | OHWFNOATKRDOLO-HUQFOHBGSA-N |
| XLogP | 3.22 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |