C12H6Cl2O2S — CID 154133923
2,8-dichloro-2H-thiopyrano[3,2-b]chromen-10-one (PubChem CID 154133923) has the molecular formula C12H6Cl2O2S and a molecular weight of 285.15 g/mol. Its IUPAC name is 2,8-dichloro-2H-thiopyrano[3,2-b]chromen-10-one.
| Compound Name | 2,8-dichloro-2H-thiopyrano[3,2-b]chromen-10-one |
|---|---|
| PubChem CID | 154133923 |
| Molecular Formula | C12H6Cl2O2S |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | 2,8-dichloro-2H-thiopyrano[3,2-b]chromen-10-one |
| SMILES | O=c1c2c(oc3ccc(Cl)cc13)C=CC(Cl)S2 |
| InChI | InChI=1S/C12H6Cl2O2S/c13-6-1-2-8-7(5-6)11(15)12-9(16-8)3-4-10(14)17-12/h1-5,10H |
| InChIKey | DPSDUGKUPNOKCP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|