About [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane
[5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 102288178) has the molecular formula C36H37BN2
and a molecular weight of 508.52 g/mol. Its IUPAC name is [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane.
Molecular Properties
| Compound Name | [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane |
| PubChem CID | 102288178 |
| Molecular Formula | C36H37BN2 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | CCn1c2ccccc2c2cc(-c3ccc(B(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)[nH]3)ccc21 |
| InChI | InChI=1S/C36H37BN2/c1-8-39-32-12-10-9-11-29(32)30-21-28(13-15-33(30)39)31-14-16-34(38-31)37(35-24(4)17-22(2)18-25(35)5)36-26(6)19-23(3)20-27(36)7/h9-21,38H,8H2,1-7H3 |
| InChIKey | MEBIVTLCKIHYBT-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane?
The IUPAC name of [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane (CID 102288178) is [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane.
What is the SMILES notation for [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane?
The canonical SMILES for [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane is CCn1c2ccccc2c2cc(-c3ccc(B(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)[nH]3)ccc21.
What is the InChIKey of [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane?
The InChIKey is MEBIVTLCKIHYBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H37BN2/c1-8-39-32-12-10-9-11-29(32)30-21-28(13-15-33(30)39)31-14-16-34(38-31)37(35-24(4)17-22(2)18-25(35)5)36-26(6)19-23(3)20-27(36)7/h9-21,38H,8H2,1-7H3.
What are the key properties of [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane?
[5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane has a molecular weight of 508.52 g/mol, XLogP of 7.18, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(9-ethylcarbazol-3-yl)-1H-pyrrol-2-yl]-bis(2,4,6-trimethylphenyl)borane is sourced from PubChem (CID 102288178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).