C37H28N8O4S2 — CID 102288529
7-[4-[3-[4-(4-oxo-3-phenyl-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-7-yl)phenoxy]propoxy]phenyl]-3-phenyl-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-4-one (PubChem CID 102288529) has the molecular formula C37H28N8O4S2 and a molecular weight of 712.82 g/mol. Its IUPAC name is 7-[4-[3-[4-(4-oxo-3-phenyl-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-7-yl)phenoxy]propoxy]phenyl]-3-phenyl-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-4-one.
| Compound Name | 7-[4-[3-[4-(4-oxo-3-phenyl-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-7-yl)phenoxy]propoxy]phenyl]-3-phenyl-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-4-one |
|---|---|
| PubChem CID | 102288529 |
| Molecular Formula | C37H28N8O4S2 |
| Molecular Weight | 712.82 g/mol |
| Exact Mass | 712.17 |
| IUPAC Name | 7-[4-[3-[4-(4-oxo-3-phenyl-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-7-yl)phenoxy]propoxy]phenyl]-3-phenyl-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-4-one |
| SMILES | O=c1c(-c2ccccc2)nnc2n1N=C(c1ccc(OCCCOc3ccc(C4=Nn5c(nnc(-c6ccccc6)c5=O)SC4)cc3)cc1)CS2 |
| InChI | InChI=1S/C37H28N8O4S2/c46-34-32(26-8-3-1-4-9-26)38-40-36-44(34)42-30(22-50-36)24-12-16-28(17-13-24)48-20-7-21-49-29-18-14-25(15-19-29)31-23-51-37-41-39-33(35(47)45(37)43-31)27-10-5-2-6-11-27/h1-6,8-19H,7,20-23H2 |
| InChIKey | HLRYAHCYVPYAQE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 138.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.82 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|