C20H12FN3OS2 — CID 9360590
12-(4-fluorophenyl)-4-phenyl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one (PubChem CID 9360590) has the molecular formula C20H12FN3OS2 and a molecular weight of 393.47 g/mol. Its IUPAC name is 12-(4-fluorophenyl)-4-phenyl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one.
| Compound Name | 12-(4-fluorophenyl)-4-phenyl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one |
|---|---|
| PubChem CID | 9360590 |
| Molecular Formula | C20H12FN3OS2 |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 12-(4-fluorophenyl)-4-phenyl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one |
| SMILES | O=c1c2c(-c3ccccc3)csc2nc2n1N=C(c1ccc(F)cc1)CS2 |
| InChI | InChI=1S/C20H12FN3OS2/c21-14-8-6-13(7-9-14)16-11-27-20-22-18-17(19(25)24(20)23-16)15(10-26-18)12-4-2-1-3-5-12/h1-10H,11H2 |
| InChIKey | HIFFFPGGFLSHNX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |