C27H25NO7 — CID 102288965
methyl (2S,3R)-3-(2,4-dimethoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methoxyphenyl)propanoate (PubChem CID 102288965) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is methyl (2S,3R)-3-(2,4-dimethoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl (2S,3R)-3-(2,4-dimethoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 102288965 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | methyl (2S,3R)-3-(2,4-dimethoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methoxyphenyl)propanoate |
| SMILES | COC(=O)[C@H]([C@H](c1ccc(OC)cc1)c1ccc(OC)cc1OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H25NO7/c1-32-17-11-9-16(10-12-17)23(21-14-13-18(33-2)15-22(21)34-3)24(27(31)35-4)28-25(29)19-7-5-6-8-20(19)26(28)30/h5-15,23-24H,1-4H3/t23-,24+/m1/s1 |
| InChIKey | JIZXUGKDNXEGAH-RPWUZVMVSA-N |
| XLogP | 3.68 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|