C30H23FN2O2 — CID 102291883
1-benzyl-5-fluoro-1',4'-diphenylspiro[indole-3,5'-pyrrolidine]-2,2'-dione (PubChem CID 102291883) has the molecular formula C30H23FN2O2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 1-benzyl-5-fluoro-1',4'-diphenylspiro[indole-3,5'-pyrrolidine]-2,2'-dione.
| Compound Name | 1-benzyl-5-fluoro-1',4'-diphenylspiro[indole-3,5'-pyrrolidine]-2,2'-dione |
|---|---|
| PubChem CID | 102291883 |
| Molecular Formula | C30H23FN2O2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 1-benzyl-5-fluoro-1',4'-diphenylspiro[indole-3,5'-pyrrolidine]-2,2'-dione |
| SMILES | O=C1CC(c2ccccc2)C2(C(=O)N(Cc3ccccc3)c3ccc(F)cc32)N1c1ccccc1 |
| InChI | InChI=1S/C30H23FN2O2/c31-23-16-17-27-26(18-23)30(29(35)32(27)20-21-10-4-1-5-11-21)25(22-12-6-2-7-13-22)19-28(34)33(30)24-14-8-3-9-15-24/h1-18,25H,19-20H2 |
| InChIKey | GALPNKUQIILCLE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |