C18H14O3 — CID 102291904
[(6R)-6-hydroxy-6-naphthalen-2-ylhexa-2,4-diynyl] acetate (PubChem CID 102291904) has the molecular formula C18H14O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is [(6R)-6-hydroxy-6-naphthalen-2-ylhexa-2,4-diynyl] acetate.
| Compound Name | [(6R)-6-hydroxy-6-naphthalen-2-ylhexa-2,4-diynyl] acetate |
|---|---|
| PubChem CID | 102291904 |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [(6R)-6-hydroxy-6-naphthalen-2-ylhexa-2,4-diynyl] acetate |
| SMILES | CC(=O)OCC#CC#C[C@H](O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H14O3/c1-14(19)21-12-6-2-3-9-18(20)17-11-10-15-7-4-5-8-16(15)13-17/h4-5,7-8,10-11,13,18,20H,12H2,1H3/t18-/m0/s1 |
| InChIKey | HNQDUYAZIMLLAI-SFHVURJKSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|