C14H12O2 — CID 46914649
1-naphthalen-2-ylbut-2-yne-1,4-diol (PubChem CID 46914649) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-naphthalen-2-ylbut-2-yne-1,4-diol.
| Compound Name | 1-naphthalen-2-ylbut-2-yne-1,4-diol |
|---|---|
| PubChem CID | 46914649 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1-naphthalen-2-ylbut-2-yne-1,4-diol |
| SMILES | OCC#CC(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H12O2/c15-9-3-6-14(16)13-8-7-11-4-1-2-5-12(11)10-13/h1-2,4-5,7-8,10,14-16H,9H2 |
| InChIKey | GLADZWFXWFMUAB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|