C21H18O3S — CID 101160197
4-(4-methylphenyl)sulfonyl-1-naphthalen-2-ylbut-2-yn-1-ol (PubChem CID 101160197) has the molecular formula C21H18O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-1-naphthalen-2-ylbut-2-yn-1-ol.
| Compound Name | 4-(4-methylphenyl)sulfonyl-1-naphthalen-2-ylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 101160197 |
| Molecular Formula | C21H18O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-1-naphthalen-2-ylbut-2-yn-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)CC#CC(O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H18O3S/c1-16-8-12-20(13-9-16)25(23,24)14-4-7-21(22)19-11-10-17-5-2-3-6-18(17)15-19/h2-3,5-6,8-13,15,21-22H,14H2,1H3 |
| InChIKey | DAYCDPJKHQUSQF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|