C12H6F5NO2S — CID 102292298
2-[2-nitro-1-(2,3,4,5,6-pentafluorophenyl)ethyl]thiophene (PubChem CID 102292298) has the molecular formula C12H6F5NO2S and a molecular weight of 323.24 g/mol. Its IUPAC name is 2-[2-nitro-1-(2,3,4,5,6-pentafluorophenyl)ethyl]thiophene.
| Compound Name | 2-[2-nitro-1-(2,3,4,5,6-pentafluorophenyl)ethyl]thiophene |
|---|---|
| PubChem CID | 102292298 |
| Molecular Formula | C12H6F5NO2S |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 2-[2-nitro-1-(2,3,4,5,6-pentafluorophenyl)ethyl]thiophene |
| SMILES | O=[N+]([O-])CC(c1cccs1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H6F5NO2S/c13-8-7(9(14)11(16)12(17)10(8)15)5(4-18(19)20)6-2-1-3-21-6/h1-3,5H,4H2 |
| InChIKey | SBOWZVTUWVCYNK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|