C10H11NO2S — CID 134985423
2-[(1S,6S)-6-nitrocyclohex-3-en-1-yl]thiophene (PubChem CID 134985423) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-[(1S,6S)-6-nitrocyclohex-3-en-1-yl]thiophene.
| Compound Name | 2-[(1S,6S)-6-nitrocyclohex-3-en-1-yl]thiophene |
|---|---|
| PubChem CID | 134985423 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-[(1S,6S)-6-nitrocyclohex-3-en-1-yl]thiophene |
| SMILES | O=[N+]([O-])[C@H]1CC=CC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C10H11NO2S/c12-11(13)9-5-2-1-4-8(9)10-6-3-7-14-10/h1-3,6-9H,4-5H2/t8-,9-/m0/s1 |
| InChIKey | ZCYYRJOMRLGRNL-IUCAKERBSA-N |
| XLogP | 2.83 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|