C29H23NO3S — CID 102292393
methyl 1,12-dimethyl-8-[(4-sulfanylphenyl)carbamoyl]benzo[c]phenanthrene-5-carboxylate (PubChem CID 102292393) has the molecular formula C29H23NO3S and a molecular weight of 465.57 g/mol. Its IUPAC name is methyl 1,12-dimethyl-8-[(4-sulfanylphenyl)carbamoyl]benzo[c]phenanthrene-5-carboxylate.
| Compound Name | methyl 1,12-dimethyl-8-[(4-sulfanylphenyl)carbamoyl]benzo[c]phenanthrene-5-carboxylate |
|---|---|
| PubChem CID | 102292393 |
| Molecular Formula | C29H23NO3S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | methyl 1,12-dimethyl-8-[(4-sulfanylphenyl)carbamoyl]benzo[c]phenanthrene-5-carboxylate |
| SMILES | COC(=O)c1cc2cc(C(=O)Nc3ccc(S)cc3)c3cccc(C)c3c2c2c(C)cccc12 |
| InChI | InChI=1S/C29H23NO3S/c1-16-6-4-8-21-23(28(31)30-19-10-12-20(34)13-11-19)14-18-15-24(29(32)33-3)22-9-5-7-17(2)26(22)27(18)25(16)21/h4-15,34H,1-3H3,(H,30,31) |
| InChIKey | OJJFEUUZCJUHLD-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|