C62H56 — CID 102292549
(1R,8S,15R,22S)-22-methyl-1,8,15-tripropyl-4-(2,3,4,5-tetraphenylphenyl)hexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9,11,13,16,18,20-nonaene (PubChem CID 102292549) has the molecular formula C62H56 and a molecular weight of 801.13 g/mol. Its IUPAC name is (1R,8S,15R,22S)-22-methyl-1,8,15-tripropyl-4-(2,3,4,5-tetraphenylphenyl)hexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9,11,13,16,18,20-nonaene.
| Compound Name | (1R,8S,15R,22S)-22-methyl-1,8,15-tripropyl-4-(2,3,4,5-tetraphenylphenyl)hexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9,11,13,16,18,20-nonaene |
|---|---|
| PubChem CID | 102292549 |
| Molecular Formula | C62H56 |
| Molecular Weight | 801.13 g/mol |
| Exact Mass | 800.44 |
| IUPAC Name | (1R,8S,15R,22S)-22-methyl-1,8,15-tripropyl-4-(2,3,4,5-tetraphenylphenyl)hexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9,11,13,16,18,20-nonaene |
| SMILES | CCC[C@@]12c3ccccc3[C@@]3(CCC)c4ccc(-c5cc(-c6ccccc6)c(-c6ccccc6)c(-c6ccccc6)c5-c5ccccc5)cc4[C@@](CCC)(c4ccccc41)[C@@]23C |
| InChI | InChI=1S/C62H56/c1-5-38-60-50-32-20-21-33-51(50)61(39-6-2)54-37-36-47(41-55(54)62(40-7-3,59(60,61)4)53-35-23-22-34-52(53)60)49-42-48(43-24-12-8-13-25-43)56(44-26-14-9-15-27-44)58(46-30-18-11-19-31-46)57(49)45-28-16-10-17-29-45/h8-37,41-42H,5-7,38-40H2,1-4H3/t59-,60+,61-,62+/m0/s1 |
| InChIKey | ZVFNBYLZLUVRBS-FQMQUDOMSA-N |
| XLogP | 16.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.13 |
| LogP ≤ 5 | 16.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |