C13H16F6N2O5 — CID 102294114
1,3-bis[(2,2,2-trifluoroacetyl)amino]propan-2-yl 5-oxohexanoate (PubChem CID 102294114) has the molecular formula C13H16F6N2O5 and a molecular weight of 394.27 g/mol. Its IUPAC name is 1,3-bis[(2,2,2-trifluoroacetyl)amino]propan-2-yl 5-oxohexanoate.
| Compound Name | 1,3-bis[(2,2,2-trifluoroacetyl)amino]propan-2-yl 5-oxohexanoate |
|---|---|
| PubChem CID | 102294114 |
| Molecular Formula | C13H16F6N2O5 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1,3-bis[(2,2,2-trifluoroacetyl)amino]propan-2-yl 5-oxohexanoate |
| SMILES | CC(=O)CCCC(=O)OC(CNC(=O)C(F)(F)F)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H16F6N2O5/c1-7(22)3-2-4-9(23)26-8(5-20-10(24)12(14,15)16)6-21-11(25)13(17,18)19/h8H,2-6H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | LVDOVLWWGJIGSX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |