About [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate
[(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate (PubChem CID 99793902) has the molecular formula C10H19NO5S
and a molecular weight of 265.33 g/mol. Its IUPAC name is [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate.
Molecular Properties
| Compound Name | [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate |
| PubChem CID | 99793902 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate |
| SMILES | CC(=O)CCCC(=O)O[C@@H](C)CNS(C)(=O)=O |
| InChI | InChI=1S/C10H19NO5S/c1-8(12)5-4-6-10(13)16-9(2)7-11-17(3,14)15/h9,11H,4-7H2,1-3H3/t9-/m0/s1 |
| InChIKey | DOXLEQWEHKDWOI-VIFPVBQESA-N |
| XLogP | 0.23 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate?
The IUPAC name of [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate (CID 99793902) is [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate.
What is the SMILES notation for [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate?
The canonical SMILES for [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate is CC(=O)CCCC(=O)O[C@@H](C)CNS(C)(=O)=O.
What is the InChIKey of [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate?
The InChIKey is DOXLEQWEHKDWOI-VIFPVBQESA-N. The full InChI is InChI=1S/C10H19NO5S/c1-8(12)5-4-6-10(13)16-9(2)7-11-17(3,14)15/h9,11H,4-7H2,1-3H3/t9-/m0/s1.
What are the key properties of [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate?
[(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate has a molecular weight of 265.33 g/mol, XLogP of 0.23, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(methanesulfonamido)propan-2-yl] 5-oxohexanoate is sourced from PubChem (CID 99793902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).