About (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one
(Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one (PubChem CID 102297063) has the molecular formula C22H27NO3S
and a molecular weight of 385.53 g/mol. Its IUPAC name is (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one |
| PubChem CID | 102297063 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one |
| SMILES | CCCSCCN/C(=C\C(=O)c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27NO3S/c1-4-14-27-15-13-23-21(17-5-9-19(25-2)10-6-17)16-22(24)18-7-11-20(26-3)12-8-18/h5-12,16,23H,4,13-15H2,1-3H3/b21-16- |
| InChIKey | MZTAUSMYEVFMQH-PGMHBOJBSA-N |
| XLogP | 4.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one?
The IUPAC name of (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one (CID 102297063) is (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one.
What is the SMILES notation for (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one?
The canonical SMILES for (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one is CCCSCCN/C(=C\C(=O)c1ccc(OC)cc1)c1ccc(OC)cc1.
What is the InChIKey of (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one?
The InChIKey is MZTAUSMYEVFMQH-PGMHBOJBSA-N. The full InChI is InChI=1S/C22H27NO3S/c1-4-14-27-15-13-23-21(17-5-9-19(25-2)10-6-17)16-22(24)18-7-11-20(26-3)12-8-18/h5-12,16,23H,4,13-15H2,1-3H3/b21-16-.
What are the key properties of (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one?
(Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one has a molecular weight of 385.53 g/mol, XLogP of 4.66, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one is sourced from PubChem (CID 102297063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).