C22H27NO3S — CID 102297063
(Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one (PubChem CID 102297063) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one.
| Compound Name | (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one |
|---|---|
| PubChem CID | 102297063 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (Z)-1,3-bis(4-methoxyphenyl)-3-(2-propylsulfanylethylamino)prop-2-en-1-one |
| SMILES | CCCSCCN/C(=C\C(=O)c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27NO3S/c1-4-14-27-15-13-23-21(17-5-9-19(25-2)10-6-17)16-22(24)18-7-11-20(26-3)12-8-18/h5-12,16,23H,4,13-15H2,1-3H3/b21-16- |
| InChIKey | MZTAUSMYEVFMQH-PGMHBOJBSA-N |
| XLogP | 4.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|