C20H20O4S — CID 1037208
1,5-bis(4-methoxyphenyl)-3-methylsulfanylpent-2-ene-1,5-dione (PubChem CID 1037208) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is 1,5-bis(4-methoxyphenyl)-3-methylsulfanylpent-2-ene-1,5-dione.
| Compound Name | 1,5-bis(4-methoxyphenyl)-3-methylsulfanylpent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 1037208 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1,5-bis(4-methoxyphenyl)-3-methylsulfanylpent-2-ene-1,5-dione |
| SMILES | COc1ccc(C(=O)C=C(CC(=O)c2ccc(OC)cc2)SC)cc1 |
| InChI | InChI=1S/C20H20O4S/c1-23-16-8-4-14(5-9-16)19(21)12-18(25-3)13-20(22)15-6-10-17(24-2)11-7-15/h4-12H,13H2,1-3H3 |
| InChIKey | VKTKOPZIDBWFCW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|