C16H18O3 — CID 143872920
(4Z)-6-methoxy-1-(4-methoxyphenyl)-3-methylidenehepta-4,6-dien-1-one (PubChem CID 143872920) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (4Z)-6-methoxy-1-(4-methoxyphenyl)-3-methylidenehepta-4,6-dien-1-one.
| Compound Name | (4Z)-6-methoxy-1-(4-methoxyphenyl)-3-methylidenehepta-4,6-dien-1-one |
|---|---|
| PubChem CID | 143872920 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (4Z)-6-methoxy-1-(4-methoxyphenyl)-3-methylidenehepta-4,6-dien-1-one |
| SMILES | C=C(/C=C\C(=C)OC)CC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H18O3/c1-12(5-6-13(2)18-3)11-16(17)14-7-9-15(19-4)10-8-14/h5-10H,1-2,11H2,3-4H3/b6-5- |
| InChIKey | FJKZQEWZLJLVJV-WAYWQWQTSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|