C15H17IO3 — CID 66927092
1-(1-iodocyclopentyl)-3-(4-methoxyphenyl)propane-1,3-dione (PubChem CID 66927092) has the molecular formula C15H17IO3 and a molecular weight of 372.20 g/mol. Its IUPAC name is 1-(1-iodocyclopentyl)-3-(4-methoxyphenyl)propane-1,3-dione.
| Compound Name | 1-(1-iodocyclopentyl)-3-(4-methoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 66927092 |
| Molecular Formula | C15H17IO3 |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 1-(1-iodocyclopentyl)-3-(4-methoxyphenyl)propane-1,3-dione |
| SMILES | COc1ccc(C(=O)CC(=O)C2(I)CCCC2)cc1 |
| InChI | InChI=1S/C15H17IO3/c1-19-12-6-4-11(5-7-12)13(17)10-14(18)15(16)8-2-3-9-15/h4-7H,2-3,8-10H2,1H3 |
| InChIKey | RCBNHRUGURUETA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|