C11H16N2O — CID 102297237
1-methylimino-2-(6-methyliminocyclohexa-2,4-dien-1-yl)propan-2-ol (PubChem CID 102297237) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-methylimino-2-(6-methyliminocyclohexa-2,4-dien-1-yl)propan-2-ol.
| Compound Name | 1-methylimino-2-(6-methyliminocyclohexa-2,4-dien-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 102297237 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-methylimino-2-(6-methyliminocyclohexa-2,4-dien-1-yl)propan-2-ol |
| SMILES | C/N=C/C(C)(O)C1C=CC=C/C1=N\C |
| InChI | InChI=1S/C11H16N2O/c1-11(14,8-12-2)9-6-4-5-7-10(9)13-3/h4-9,14H,1-3H3/b12-8+,13-10+ |
| InChIKey | IPIDGCJMAXOGML-SDCOAONHSA-N |
| XLogP | 1.25 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|