C12H18N2 — CID 156793504
N',2-dimethyl-N-(6-methylcyclohexa-2,4-dien-1-ylidene)propanimidamide (PubChem CID 156793504) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N',2-dimethyl-N-(6-methylcyclohexa-2,4-dien-1-ylidene)propanimidamide.
| Compound Name | N',2-dimethyl-N-(6-methylcyclohexa-2,4-dien-1-ylidene)propanimidamide |
|---|---|
| PubChem CID | 156793504 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N',2-dimethyl-N-(6-methylcyclohexa-2,4-dien-1-ylidene)propanimidamide |
| SMILES | C/N=C(/N=C1\C=CC=CC1C)C(C)C |
| InChI | InChI=1S/C12H18N2/c1-9(2)12(13-4)14-11-8-6-5-7-10(11)3/h5-10H,1-4H3/b13-12+,14-11+ |
| InChIKey | LCBFUBXCGQWIGI-UIGAKZAYSA-N |
| XLogP | 2.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|