C8H9N3 — CID 143207550
4-methyl-2,4-dihydrocyclohepta[d]triazole (PubChem CID 143207550) has the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. Its IUPAC name is 4-methyl-2,4-dihydrocyclohepta[d]triazole.
| Compound Name | 4-methyl-2,4-dihydrocyclohepta[d]triazole |
|---|---|
| PubChem CID | 143207550 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 4-methyl-2,4-dihydrocyclohepta[d]triazole |
| SMILES | CC1C=CC=Cc2n[nH]nc21 |
| InChI | InChI=1S/C8H9N3/c1-6-4-2-3-5-7-8(6)10-11-9-7/h2-6H,1H3,(H,9,10,11) |
| InChIKey | LJQOLUZUMXJSJV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |