C39H35NOS6 — CID 102298180
4,5,9,10-tetrakis(2,5-dimethylthiophen-3-yl)-7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 102298180) has the molecular formula C39H35NOS6 and a molecular weight of 726.12 g/mol. Its IUPAC name is 4,5,9,10-tetrakis(2,5-dimethylthiophen-3-yl)-7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,5,9,10-tetrakis(2,5-dimethylthiophen-3-yl)-7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 102298180 |
| Molecular Formula | C39H35NOS6 |
| Molecular Weight | 726.12 g/mol |
| Exact Mass | 725.10 |
| IUPAC Name | 4,5,9,10-tetrakis(2,5-dimethylthiophen-3-yl)-7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | COc1ccc(-n2c3c(-c4cc(C)sc4C)c(-c4cc(C)sc4C)sc3c3sc(-c4cc(C)sc4C)c(-c4cc(C)sc4C)c32)cc1 |
| InChI | InChI=1S/C39H35NOS6/c1-18-14-28(22(5)42-18)32-34-38(46-36(32)30-16-20(3)44-24(30)7)39-35(40(34)26-10-12-27(41-9)13-11-26)33(29-15-19(2)43-23(29)6)37(47-39)31-17-21(4)45-25(31)8/h10-17H,1-9H3 |
| InChIKey | PXBWYARBJVKYMY-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.12 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |