C46H43N3O4S2 — CID 90890940
7-(4-tert-butylphenyl)-4-N,4-N,10-N,10-N-tetrakis(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-diamine (PubChem CID 90890940) has the molecular formula C46H43N3O4S2 and a molecular weight of 766.00 g/mol. Its IUPAC name is 7-(4-tert-butylphenyl)-4-N,4-N,10-N,10-N-tetrakis(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-diamine.
| Compound Name | 7-(4-tert-butylphenyl)-4-N,4-N,10-N,10-N-tetrakis(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-diamine |
|---|---|
| PubChem CID | 90890940 |
| Molecular Formula | C46H43N3O4S2 |
| Molecular Weight | 766.00 g/mol |
| Exact Mass | 765.27 |
| IUPAC Name | 7-(4-tert-butylphenyl)-4-N,4-N,10-N,10-N-tetrakis(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2cc3c(s2)c2sc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc2n3-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C46H43N3O4S2/c1-46(2,3)30-8-10-35(11-9-30)49-40-28-42(47(31-12-20-36(50-4)21-13-31)32-14-22-37(51-5)23-15-32)54-44(40)45-41(49)29-43(55-45)48(33-16-24-38(52-6)25-17-33)34-18-26-39(53-7)27-19-34/h8-29H,1-7H3 |
| InChIKey | CUJSPPXWYGYQNR-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.00 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |