C49H54N2O3S2 — CID 139594029
10-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde (PubChem CID 139594029) has the molecular formula C49H54N2O3S2 and a molecular weight of 783.12 g/mol. Its IUPAC name is 10-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde.
| Compound Name | 10-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
|---|---|
| PubChem CID | 139594029 |
| Molecular Formula | C49H54N2O3S2 |
| Molecular Weight | 783.12 g/mol |
| Exact Mass | 782.36 |
| IUPAC Name | 10-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
| SMILES | CCCCC(CC)COc1ccc(N(c2ccc(OCC(CC)CCCC)cc2)c2ccc(-c3cc4c(s3)c3sc(C=O)cc3n4-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C49H54N2O3S2/c1-5-9-14-35(7-3)33-53-42-26-22-40(23-27-42)50(41-24-28-43(29-25-41)54-34-36(8-4)15-10-6-2)39-20-18-37(19-21-39)47-31-46-49(56-47)48-45(30-44(32-52)55-48)51(46)38-16-12-11-13-17-38/h11-13,16-32,35-36H,5-10,14-15,33-34H2,1-4H3 |
| InChIKey | PLFNWEFXVDJNOB-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.12 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|