C63H83N3O3S4 — CID 139260705
5-[5-[5-[4-(4-octoxy-N-(4-octoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde (PubChem CID 139260705) has the molecular formula C63H83N3O3S4 and a molecular weight of 1058.64 g/mol. Its IUPAC name is 5-[5-[5-[4-(4-octoxy-N-(4-octoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde.
| Compound Name | 5-[5-[5-[4-(4-octoxy-N-(4-octoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139260705 |
| Molecular Formula | C63H83N3O3S4 |
| Molecular Weight | 1058.64 g/mol |
| Exact Mass | 1057.53 |
| IUPAC Name | 5-[5-[5-[4-(4-octoxy-N-(4-octoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde |
| SMILES | CCCCCCCCOc1ccc(N(c2ccc(OCCCCCCCC)cc2)c2ccc(-c3cc(CCCCCCCC)c(-c4nc5sc(-c6sc(C=O)cc6CCCCCCCC)nc5s4)s3)cc2)cc1 |
| InChI | InChI=1S/C63H83N3O3S4/c1-5-9-13-17-21-25-29-49-45-56(47-67)70-58(49)60-64-62-63(72-60)65-61(73-62)59-50(30-26-22-18-14-10-6-2)46-57(71-59)48-31-33-51(34-32-48)66(52-35-39-54(40-36-52)68-43-27-23-19-15-11-7-3)53-37-41-55(42-38-53)69-44-28-24-20-16-12-8-4/h31-42,45-47H,5-30,43-44H2,1-4H3 |
| InChIKey | DICBZKSTJRHZKX-UHFFFAOYSA-N |
| XLogP | 21.44 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.64 |
| LogP ≤ 5 | 21.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|