C55H67N3O3S4 — CID 139260704
5-[5-[5-[4-(4-butoxy-N-(4-butoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde (PubChem CID 139260704) has the molecular formula C55H67N3O3S4 and a molecular weight of 946.43 g/mol. Its IUPAC name is 5-[5-[5-[4-(4-butoxy-N-(4-butoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde.
| Compound Name | 5-[5-[5-[4-(4-butoxy-N-(4-butoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139260704 |
| Molecular Formula | C55H67N3O3S4 |
| Molecular Weight | 946.43 g/mol |
| Exact Mass | 945.41 |
| IUPAC Name | 5-[5-[5-[4-(4-butoxy-N-(4-butoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde |
| SMILES | CCCCCCCCc1cc(C=O)sc1-c1nc2sc(-c3sc(-c4ccc(N(c5ccc(OCCCC)cc5)c5ccc(OCCCC)cc5)cc4)cc3CCCCCCCC)nc2s1 |
| InChI | InChI=1S/C55H67N3O3S4/c1-5-9-13-15-17-19-21-41-37-48(39-59)62-50(41)52-56-54-55(64-52)57-53(65-54)51-42(22-20-18-16-14-10-6-2)38-49(63-51)40-23-25-43(26-24-40)58(44-27-31-46(32-28-44)60-35-11-7-3)45-29-33-47(34-30-45)61-36-12-8-4/h23-34,37-39H,5-22,35-36H2,1-4H3 |
| InChIKey | FPKDDJLJJNRCAW-UHFFFAOYSA-N |
| XLogP | 18.32 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.43 |
| LogP ≤ 5 | 18.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|