C44H46IN3O2S4 — CID 71613486
4-[3-hexyl-5-[5-(4-hexyl-5-iodothiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophen-2-yl]-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 71613486) has the molecular formula C44H46IN3O2S4 and a molecular weight of 904.04 g/mol. Its IUPAC name is 4-[3-hexyl-5-[5-(4-hexyl-5-iodothiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophen-2-yl]-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 4-[3-hexyl-5-[5-(4-hexyl-5-iodothiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophen-2-yl]-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 71613486 |
| Molecular Formula | C44H46IN3O2S4 |
| Molecular Weight | 904.04 g/mol |
| Exact Mass | 903.15 |
| IUPAC Name | 4-[3-hexyl-5-[5-(4-hexyl-5-iodothiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophen-2-yl]-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | CCCCCCc1cc(-c2nc3sc(-c4cc(CCCCCC)c(-c5ccc(N(c6ccc(OC)cc6)c6ccc(OC)cc6)cc5)s4)nc3s2)sc1I |
| InChI | InChI=1S/C44H46IN3O2S4/c1-5-7-9-11-13-30-27-37(41-46-43-44(53-41)47-42(54-43)38-28-31(40(45)52-38)14-12-10-8-6-2)51-39(30)29-15-17-32(18-16-29)48(33-19-23-35(49-3)24-20-33)34-21-25-36(50-4)26-22-34/h15-28H,5-14H2,1-4H3 |
| InChIKey | PMRIQEWKKGOUIJ-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.04 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|